C23H31N3O6S — CID 135610119
ethyl 2-[2-[2-[(5-carbamimidoyl-2-hydroxyphenyl)sulfonylamino]ethyl]-5-propan-2-ylphenoxy]propanoate (PubChem CID 135610119) has the molecular formula C23H31N3O6S and a molecular weight of 477.58 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(5-carbamimidoyl-2-hydroxyphenyl)sulfonylamino]ethyl]-5-propan-2-ylphenoxy]propanoate.
| Compound Name | ethyl 2-[2-[2-[(5-carbamimidoyl-2-hydroxyphenyl)sulfonylamino]ethyl]-5-propan-2-ylphenoxy]propanoate |
|---|---|
| PubChem CID | 135610119 |
| Molecular Formula | C23H31N3O6S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | ethyl 2-[2-[2-[(5-carbamimidoyl-2-hydroxyphenyl)sulfonylamino]ethyl]-5-propan-2-ylphenoxy]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(O)c(S(=O)(=O)NCCc2ccc(C(C)C)cc2OC(C)C(=O)OCC)c1 |
| InChI | InChI=1S/C23H31N3O6S/c1-5-31-23(28)15(4)32-20-12-17(14(2)3)7-6-16(20)10-11-26-33(29,30)21-13-18(22(24)25)8-9-19(21)27/h6-9,12-15,26-27H,5,10-11H2,1-4H3,(H3,24,25) |
| InChIKey | PLMIGILLTLYLRZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 151.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|