C22H19BrCl2FN5O2 — CID 135611175
4-bromo-2-chloro-3-(2-chloro-6-methylphenyl)-6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 135611175) has the molecular formula C22H19BrCl2FN5O2 and a molecular weight of 555.24 g/mol. Its IUPAC name is 4-bromo-2-chloro-3-(2-chloro-6-methylphenyl)-6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-bromo-2-chloro-3-(2-chloro-6-methylphenyl)-6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135611175 |
| Molecular Formula | C22H19BrCl2FN5O2 |
| Molecular Weight | 555.24 g/mol |
| Exact Mass | 553.01 |
| IUPAC Name | 4-bromo-2-chloro-3-(2-chloro-6-methylphenyl)-6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1cccc(Cl)c1-c1c(Br)cc(/C=N\Nc2ncc(F)c(N3CCOCC3)n2)c(O)c1Cl |
| InChI | InChI=1S/C22H19BrCl2FN5O2/c1-12-3-2-4-15(24)17(12)18-14(23)9-13(20(32)19(18)25)10-28-30-22-27-11-16(26)21(29-22)31-5-7-33-8-6-31/h2-4,9-11,32H,5-8H2,1H3,(H,27,29,30)/b28-10- |
| InChIKey | CQOQQJDBQUWNKM-LGUSAWBASA-N |
| XLogP | 5.65 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.24 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|