C16H16BrClFN5O — CID 135491941
4-bromo-2-chloro-6-[(E)-[(5-fluoro-4-piperidin-1-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 135491941) has the molecular formula C16H16BrClFN5O and a molecular weight of 428.69 g/mol. Its IUPAC name is 4-bromo-2-chloro-6-[(E)-[(5-fluoro-4-piperidin-1-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-bromo-2-chloro-6-[(E)-[(5-fluoro-4-piperidin-1-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135491941 |
| Molecular Formula | C16H16BrClFN5O |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 4-bromo-2-chloro-6-[(E)-[(5-fluoro-4-piperidin-1-ylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1c(Cl)cc(Br)cc1/C=N/Nc1ncc(F)c(N2CCCCC2)n1 |
| InChI | InChI=1S/C16H16BrClFN5O/c17-11-6-10(14(25)12(18)7-11)8-21-23-16-20-9-13(19)15(22-16)24-4-2-1-3-5-24/h6-9,25H,1-5H2,(H,20,22,23)/b21-8+ |
| InChIKey | PDHKDULDZKQELC-ODCIPOBUSA-N |
| XLogP | 4.17 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|