C17H18N3O+ — CID 135612861
(4-oxo-3H-quinazolin-2-yl)methyl-[(1S)-1-phenylethyl]azanium (PubChem CID 135612861) has the molecular formula C17H18N3O+ and a molecular weight of 280.35 g/mol. Its IUPAC name is (4-oxo-3H-quinazolin-2-yl)methyl-[(1S)-1-phenylethyl]azanium.
| Compound Name | (4-oxo-3H-quinazolin-2-yl)methyl-[(1S)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 135612861 |
| Molecular Formula | C17H18N3O+ |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (4-oxo-3H-quinazolin-2-yl)methyl-[(1S)-1-phenylethyl]azanium |
| SMILES | C[C@H]([NH2+]Cc1nc2ccccc2c(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O/c1-12(13-7-3-2-4-8-13)18-11-16-19-15-10-6-5-9-14(15)17(21)20-16/h2-10,12,18H,11H2,1H3,(H,19,20,21)/p+1/t12-/m0/s1 |
| InChIKey | RPQDFWLDFGGRKB-LBPRGKRZSA-O |
| XLogP | 1.75 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |