C15H16N3O2+ — CID 135751338
[(1S)-1-(furan-2-yl)ethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium (PubChem CID 135751338) has the molecular formula C15H16N3O2+ and a molecular weight of 270.31 g/mol. Its IUPAC name is [(1S)-1-(furan-2-yl)ethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium.
| Compound Name | [(1S)-1-(furan-2-yl)ethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 135751338 |
| Molecular Formula | C15H16N3O2+ |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [(1S)-1-(furan-2-yl)ethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
| SMILES | C[C@H]([NH2+]Cc1nc2ccccc2c(=O)[nH]1)c1ccco1 |
| InChI | InChI=1S/C15H15N3O2/c1-10(13-7-4-8-20-13)16-9-14-17-12-6-3-2-5-11(12)15(19)18-14/h2-8,10,16H,9H2,1H3,(H,17,18,19)/p+1/t10-/m0/s1 |
| InChIKey | SDXNXTMQHBPQGF-JTQLQIEISA-O |
| XLogP | 1.34 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |