C24H27N5O5 — CID 135616304
N-(2,5-dimethoxyphenyl)-8-(3,4-dimethoxyphenyl)-4,7-dimethyl-1,2-dihydropyrazolo[5,1-c][1,2,4]triazine-3-carboxamide (PubChem CID 135616304) has the molecular formula C24H27N5O5 and a molecular weight of 465.51 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-8-(3,4-dimethoxyphenyl)-4,7-dimethyl-1,2-dihydropyrazolo[5,1-c][1,2,4]triazine-3-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-8-(3,4-dimethoxyphenyl)-4,7-dimethyl-1,2-dihydropyrazolo[5,1-c][1,2,4]triazine-3-carboxamide |
|---|---|
| PubChem CID | 135616304 |
| Molecular Formula | C24H27N5O5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-8-(3,4-dimethoxyphenyl)-4,7-dimethyl-1,2-dihydropyrazolo[5,1-c][1,2,4]triazine-3-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2=C(C)n3nc(C)c(-c4ccc(OC)c(OC)c4)c3NN2)c1 |
| InChI | InChI=1S/C24H27N5O5/c1-13-21(15-7-9-19(33-5)20(11-15)34-6)23-27-26-22(14(2)29(23)28-13)24(30)25-17-12-16(31-3)8-10-18(17)32-4/h7-12,26-27H,1-6H3,(H,25,30) |
| InChIKey | SOPJCMMNHMVRSZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 107.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |