C21H23N5O — CID 135617673
4-(3,4-dihydro-2H-chromen-8-yl)-5-isocyano-6-piperidin-4-yl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 135617673) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-chromen-8-yl)-5-isocyano-6-piperidin-4-yl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 4-(3,4-dihydro-2H-chromen-8-yl)-5-isocyano-6-piperidin-4-yl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 135617673 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 4-(3,4-dihydro-2H-chromen-8-yl)-5-isocyano-6-piperidin-4-yl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | [C-]#[N+]C1=C(C2CCNCC2)Nc2[nH]ncc2C1c1cccc2c1OCCC2 |
| InChI | InChI=1S/C21H23N5O/c1-22-19-17(15-6-2-4-14-5-3-11-27-20(14)15)16-12-24-26-21(16)25-18(19)13-7-9-23-10-8-13/h2,4,6,12-13,17,23H,3,5,7-11H2,(H2,24,25,26) |
| InChIKey | GJBKCQYCNOYLEW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|