C17H16N6O — CID 135617647
4-(6-tert-butyl-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)-2,1,3-benzoxadiazole (PubChem CID 135617647) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is 4-(6-tert-butyl-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)-2,1,3-benzoxadiazole.
| Compound Name | 4-(6-tert-butyl-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 135617647 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 4-(6-tert-butyl-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)-2,1,3-benzoxadiazole |
| SMILES | [C-]#[N+]C1=C(C(C)(C)C)Nc2[nH]ncc2C1c1cccc2nonc12 |
| InChI | InChI=1S/C17H16N6O/c1-17(2,3)15-14(18-4)12(10-8-19-21-16(10)20-15)9-6-5-7-11-13(9)23-24-22-11/h5-8,12H,1-3H3,(H2,19,20,21) |
| InChIKey | KVQUDXNCIULDQD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|