C20H15ClN4O — CID 135617475
4-(2-chlorophenyl)-5-isocyano-6-(4-methoxyphenyl)-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 135617475) has the molecular formula C20H15ClN4O and a molecular weight of 362.82 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-5-isocyano-6-(4-methoxyphenyl)-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 4-(2-chlorophenyl)-5-isocyano-6-(4-methoxyphenyl)-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 135617475 |
| Molecular Formula | C20H15ClN4O |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 4-(2-chlorophenyl)-5-isocyano-6-(4-methoxyphenyl)-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | [C-]#[N+]C1=C(c2ccc(OC)cc2)Nc2[nH]ncc2C1c1ccccc1Cl |
| InChI | InChI=1S/C20H15ClN4O/c1-22-19-17(14-5-3-4-6-16(14)21)15-11-23-25-20(15)24-18(19)12-7-9-13(26-2)10-8-12/h3-11,17H,2H3,(H2,23,24,25) |
| InChIKey | HXLHIIYZVITAFY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|