C16H15ClN4O2 — CID 135617493
4-(2-chlorophenyl)-6-(dimethoxymethyl)-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 135617493) has the molecular formula C16H15ClN4O2 and a molecular weight of 330.78 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-6-(dimethoxymethyl)-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 4-(2-chlorophenyl)-6-(dimethoxymethyl)-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 135617493 |
| Molecular Formula | C16H15ClN4O2 |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 4-(2-chlorophenyl)-6-(dimethoxymethyl)-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | [C-]#[N+]C1=C(C(OC)OC)Nc2[nH]ncc2C1c1ccccc1Cl |
| InChI | InChI=1S/C16H15ClN4O2/c1-18-13-12(9-6-4-5-7-11(9)17)10-8-19-21-15(10)20-14(13)16(22-2)23-3/h4-8,12,16H,2-3H3,(H2,19,20,21) |
| InChIKey | SBGWOKIXAFAONT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|