C19H16N6O2 — CID 135617506
2-[4-(2,1,3-benzoxadiazol-4-yl)-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-6-yl]cyclohexan-1-one (PubChem CID 135617506) has the molecular formula C19H16N6O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is 2-[4-(2,1,3-benzoxadiazol-4-yl)-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-6-yl]cyclohexan-1-one.
| Compound Name | 2-[4-(2,1,3-benzoxadiazol-4-yl)-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-6-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 135617506 |
| Molecular Formula | C19H16N6O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[4-(2,1,3-benzoxadiazol-4-yl)-5-isocyano-4,7-dihydro-1H-pyrazolo[5,4-b]pyridin-6-yl]cyclohexan-1-one |
| SMILES | [C-]#[N+]C1=C(C2CCCCC2=O)Nc2[nH]ncc2C1c1cccc2nonc12 |
| InChI | InChI=1S/C19H16N6O2/c1-20-18-15(11-6-4-7-13-16(11)25-27-24-13)12-9-21-23-19(12)22-17(18)10-5-2-3-8-14(10)26/h4,6-7,9-10,15H,2-3,5,8H2,(H2,21,22,23) |
| InChIKey | WLDSJLXAYMENBN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|