C21H20F3NO — CID 135618705
1,3-difluoro-6-(6-fluoro-5-hexyl-2-pyridinyl)naphthalen-2-ol (PubChem CID 135618705) has the molecular formula C21H20F3NO and a molecular weight of 359.39 g/mol. Its IUPAC name is 1,3-difluoro-6-(6-fluoro-5-hexyl-2-pyridinyl)naphthalen-2-ol.
| Compound Name | 1,3-difluoro-6-(6-fluoro-5-hexyl-2-pyridinyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 135618705 |
| Molecular Formula | C21H20F3NO |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1,3-difluoro-6-(6-fluoro-5-hexyl-2-pyridinyl)naphthalen-2-ol |
| SMILES | CCCCCCc1ccc(-c2ccc3c(F)c(O)c(F)cc3c2)nc1F |
| InChI | InChI=1S/C21H20F3NO/c1-2-3-4-5-6-13-8-10-18(25-21(13)24)14-7-9-16-15(11-14)12-17(22)20(26)19(16)23/h7-12,26H,2-6H2,1H3 |
| InChIKey | ZQHOWZNJVLAESN-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|