C19H19ClN4OS — CID 135619606
(NE)-N-[[5-(3-chlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-3-ylmethyl)imidazol-2-yl]methylidene]hydroxylamine (PubChem CID 135619606) has the molecular formula C19H19ClN4OS and a molecular weight of 386.91 g/mol. Its IUPAC name is (NE)-N-[[5-(3-chlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-3-ylmethyl)imidazol-2-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[5-(3-chlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-3-ylmethyl)imidazol-2-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135619606 |
| Molecular Formula | C19H19ClN4OS |
| Molecular Weight | 386.91 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (NE)-N-[[5-(3-chlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-3-ylmethyl)imidazol-2-yl]methylidene]hydroxylamine |
| SMILES | CC(C)c1nc(/C=N/O)n(Cc2cccnc2)c1Sc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H19ClN4OS/c1-13(2)18-19(26-16-7-3-6-15(20)9-16)24(17(23-18)11-22-25)12-14-5-4-8-21-10-14/h3-11,13,25H,12H2,1-2H3/b22-11+ |
| InChIKey | KGJBRSKGXBJCKK-SSDVNMTOSA-N |
| XLogP | 5.06 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.91 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|