C20H21N7O2S — CID 22130047
3-[[2-(2-azidoethyl)-5-(3-nitrophenyl)sulfanyl-4-propan-2-ylimidazol-1-yl]methyl]pyridine (PubChem CID 22130047) has the molecular formula C20H21N7O2S and a molecular weight of 423.50 g/mol. Its IUPAC name is 3-[[2-(2-azidoethyl)-5-(3-nitrophenyl)sulfanyl-4-propan-2-ylimidazol-1-yl]methyl]pyridine.
| Compound Name | 3-[[2-(2-azidoethyl)-5-(3-nitrophenyl)sulfanyl-4-propan-2-ylimidazol-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 22130047 |
| Molecular Formula | C20H21N7O2S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 3-[[2-(2-azidoethyl)-5-(3-nitrophenyl)sulfanyl-4-propan-2-ylimidazol-1-yl]methyl]pyridine |
| SMILES | CC(C)c1nc(CCN=[N+]=[N-])n(Cc2cccnc2)c1Sc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21N7O2S/c1-14(2)19-20(30-17-7-3-6-16(11-17)27(28)29)26(13-15-5-4-9-22-12-15)18(24-19)8-10-23-25-21/h3-7,9,11-12,14H,8,10,13H2,1-2H3 |
| InChIKey | QEVGZSLCHUKYFZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 122.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|