C23H27N3O3S — CID 22130140
5-(3-nitrophenyl)sulfanyl-2-(phenylmethoxymethyl)-4-propan-2-yl-1-propylimidazole (PubChem CID 22130140) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 5-(3-nitrophenyl)sulfanyl-2-(phenylmethoxymethyl)-4-propan-2-yl-1-propylimidazole.
| Compound Name | 5-(3-nitrophenyl)sulfanyl-2-(phenylmethoxymethyl)-4-propan-2-yl-1-propylimidazole |
|---|---|
| PubChem CID | 22130140 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 5-(3-nitrophenyl)sulfanyl-2-(phenylmethoxymethyl)-4-propan-2-yl-1-propylimidazole |
| SMILES | CCCn1c(COCc2ccccc2)nc(C(C)C)c1Sc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H27N3O3S/c1-4-13-25-21(16-29-15-18-9-6-5-7-10-18)24-22(17(2)3)23(25)30-20-12-8-11-19(14-20)26(27)28/h5-12,14,17H,4,13,15-16H2,1-3H3 |
| InChIKey | ITSAWFXBBXCMIP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|