C16H22N6O2S — CID 22130668
2-[[1-ethyl-5-(3-nitrophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]methyl]guanidine (PubChem CID 22130668) has the molecular formula C16H22N6O2S and a molecular weight of 362.46 g/mol. Its IUPAC name is 2-[[1-ethyl-5-(3-nitrophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]methyl]guanidine.
| Compound Name | 2-[[1-ethyl-5-(3-nitrophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 22130668 |
| Molecular Formula | C16H22N6O2S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[[1-ethyl-5-(3-nitrophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]methyl]guanidine |
| SMILES | CCn1c(CN=C(N)N)nc(C(C)C)c1Sc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H22N6O2S/c1-4-21-13(9-19-16(17)18)20-14(10(2)3)15(21)25-12-7-5-6-11(8-12)22(23)24/h5-8,10H,4,9H2,1-3H3,(H4,17,18,19) |
| InChIKey | YDHHBNOWYAWXJC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|