C20H22N6O3S — CID 174340964
phenyl 2-(2-azidoethyl)-5-propan-2-yl-3-(pyridin-3-ylmethyl)imidazole-4-sulfonate (PubChem CID 174340964) has the molecular formula C20H22N6O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is phenyl 2-(2-azidoethyl)-5-propan-2-yl-3-(pyridin-3-ylmethyl)imidazole-4-sulfonate.
| Compound Name | phenyl 2-(2-azidoethyl)-5-propan-2-yl-3-(pyridin-3-ylmethyl)imidazole-4-sulfonate |
|---|---|
| PubChem CID | 174340964 |
| Molecular Formula | C20H22N6O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | phenyl 2-(2-azidoethyl)-5-propan-2-yl-3-(pyridin-3-ylmethyl)imidazole-4-sulfonate |
| SMILES | CC(C)c1nc(CCN=[N+]=[N-])n(Cc2cccnc2)c1S(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H22N6O3S/c1-15(2)19-20(30(27,28)29-17-8-4-3-5-9-17)26(14-16-7-6-11-22-13-16)18(24-19)10-12-23-25-21/h3-9,11,13,15H,10,12,14H2,1-2H3 |
| InChIKey | KHMJPDDKDMURHW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 122.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|