C20H20F2N6S — CID 139729924
2-[[2-(2-azidoethyl)-5-(3,5-difluorophenyl)sulfanyl-4-propan-2-ylimidazol-1-yl]methyl]pyridine (PubChem CID 139729924) has the molecular formula C20H20F2N6S and a molecular weight of 414.49 g/mol. Its IUPAC name is 2-[[2-(2-azidoethyl)-5-(3,5-difluorophenyl)sulfanyl-4-propan-2-ylimidazol-1-yl]methyl]pyridine.
| Compound Name | 2-[[2-(2-azidoethyl)-5-(3,5-difluorophenyl)sulfanyl-4-propan-2-ylimidazol-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 139729924 |
| Molecular Formula | C20H20F2N6S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-[[2-(2-azidoethyl)-5-(3,5-difluorophenyl)sulfanyl-4-propan-2-ylimidazol-1-yl]methyl]pyridine |
| SMILES | CC(C)c1nc(CCN=[N+]=[N-])n(Cc2ccccn2)c1Sc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C20H20F2N6S/c1-13(2)19-20(29-17-10-14(21)9-15(22)11-17)28(12-16-5-3-4-7-24-16)18(26-19)6-8-25-27-23/h3-5,7,9-11,13H,6,8,12H2,1-2H3 |
| InChIKey | DOGNUIAQXKJUES-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 79.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|