C15H18FN5S — CID 140978530
2-(2-azidoethyl)-5-(3-fluorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazole (PubChem CID 140978530) has the molecular formula C15H18FN5S and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-(2-azidoethyl)-5-(3-fluorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazole.
| Compound Name | 2-(2-azidoethyl)-5-(3-fluorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazole |
|---|---|
| PubChem CID | 140978530 |
| Molecular Formula | C15H18FN5S |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-(2-azidoethyl)-5-(3-fluorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazole |
| SMILES | CC(C)c1nc(CCN=[N+]=[N-])n(C)c1Sc1cccc(F)c1 |
| InChI | InChI=1S/C15H18FN5S/c1-10(2)14-15(22-12-6-4-5-11(16)9-12)21(3)13(19-14)7-8-18-20-17/h4-6,9-10H,7-8H2,1-3H3 |
| InChIKey | OKDSIQSYNIYERQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|