C14H16ClN5S — CID 140978488
2-(azidomethyl)-5-(3-chlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazole (PubChem CID 140978488) has the molecular formula C14H16ClN5S and a molecular weight of 321.84 g/mol. Its IUPAC name is 2-(azidomethyl)-5-(3-chlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazole.
| Compound Name | 2-(azidomethyl)-5-(3-chlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazole |
|---|---|
| PubChem CID | 140978488 |
| Molecular Formula | C14H16ClN5S |
| Molecular Weight | 321.84 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-(azidomethyl)-5-(3-chlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazole |
| SMILES | CC(C)c1nc(CN=[N+]=[N-])n(C)c1Sc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H16ClN5S/c1-9(2)13-14(20(3)12(18-13)8-17-19-16)21-11-6-4-5-10(15)7-11/h4-7,9H,8H2,1-3H3 |
| InChIKey | BHUFMXNPGOAZPV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.84 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|