C19H19ClN6S — CID 22130354
4-[[2-(azidomethyl)-4-(3-chlorophenyl)sulfanyl-5-propan-2-ylimidazol-1-yl]methyl]pyridine (PubChem CID 22130354) has the molecular formula C19H19ClN6S and a molecular weight of 398.92 g/mol. Its IUPAC name is 4-[[2-(azidomethyl)-4-(3-chlorophenyl)sulfanyl-5-propan-2-ylimidazol-1-yl]methyl]pyridine.
| Compound Name | 4-[[2-(azidomethyl)-4-(3-chlorophenyl)sulfanyl-5-propan-2-ylimidazol-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 22130354 |
| Molecular Formula | C19H19ClN6S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 4-[[2-(azidomethyl)-4-(3-chlorophenyl)sulfanyl-5-propan-2-ylimidazol-1-yl]methyl]pyridine |
| SMILES | CC(C)c1c(Sc2cccc(Cl)c2)nc(CN=[N+]=[N-])n1Cc1ccncc1 |
| InChI | InChI=1S/C19H19ClN6S/c1-13(2)18-19(27-16-5-3-4-15(20)10-16)24-17(11-23-25-21)26(18)12-14-6-8-22-9-7-14/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | TXJWCLHJOVGQAF-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 79.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|