C20H19Cl2N5S — CID 22130113
2-(azidomethyl)-1-benzyl-5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-ylimidazole (PubChem CID 22130113) has the molecular formula C20H19Cl2N5S and a molecular weight of 432.38 g/mol. Its IUPAC name is 2-(azidomethyl)-1-benzyl-5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-ylimidazole.
| Compound Name | 2-(azidomethyl)-1-benzyl-5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-ylimidazole |
|---|---|
| PubChem CID | 22130113 |
| Molecular Formula | C20H19Cl2N5S |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 2-(azidomethyl)-1-benzyl-5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-ylimidazole |
| SMILES | CC(C)c1nc(CN=[N+]=[N-])n(Cc2ccccc2)c1Sc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N5S/c1-13(2)19-20(28-17-9-15(21)8-16(22)10-17)27(18(25-19)11-24-26-23)12-14-6-4-3-5-7-14/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | OAQDYGMXGBKHQH-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|