C22H23Cl2N2O6PS — CID 143072739
[4-[[5-(3,5-dichlorophenyl)sulfanyl-2-(formyloxymethyl)-4-propan-2-ylimidazol-1-yl]methyl]phenoxy]methylphosphonic acid (PubChem CID 143072739) has the molecular formula C22H23Cl2N2O6PS and a molecular weight of 545.38 g/mol. Its IUPAC name is [4-[[5-(3,5-dichlorophenyl)sulfanyl-2-(formyloxymethyl)-4-propan-2-ylimidazol-1-yl]methyl]phenoxy]methylphosphonic acid.
| Compound Name | [4-[[5-(3,5-dichlorophenyl)sulfanyl-2-(formyloxymethyl)-4-propan-2-ylimidazol-1-yl]methyl]phenoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 143072739 |
| Molecular Formula | C22H23Cl2N2O6PS |
| Molecular Weight | 545.38 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | [4-[[5-(3,5-dichlorophenyl)sulfanyl-2-(formyloxymethyl)-4-propan-2-ylimidazol-1-yl]methyl]phenoxy]methylphosphonic acid |
| SMILES | CC(C)c1nc(COC=O)n(Cc2ccc(OCP(=O)(O)O)cc2)c1Sc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H23Cl2N2O6PS/c1-14(2)21-22(34-19-8-16(23)7-17(24)9-19)26(20(25-21)11-31-12-27)10-15-3-5-18(6-4-15)32-13-33(28,29)30/h3-9,12,14H,10-11,13H2,1-2H3,(H2,28,29,30) |
| InChIKey | NYKKTVCUDKCZOS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.38 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|