C24H26Cl2N2O2S — CID 22130701
5-(3,5-dichlorophenyl)sulfanyl-2-[(4-methoxyphenyl)methoxymethyl]-4-propan-2-yl-1-prop-2-enylimidazole (PubChem CID 22130701) has the molecular formula C24H26Cl2N2O2S and a molecular weight of 477.46 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)sulfanyl-2-[(4-methoxyphenyl)methoxymethyl]-4-propan-2-yl-1-prop-2-enylimidazole.
| Compound Name | 5-(3,5-dichlorophenyl)sulfanyl-2-[(4-methoxyphenyl)methoxymethyl]-4-propan-2-yl-1-prop-2-enylimidazole |
|---|---|
| PubChem CID | 22130701 |
| Molecular Formula | C24H26Cl2N2O2S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 5-(3,5-dichlorophenyl)sulfanyl-2-[(4-methoxyphenyl)methoxymethyl]-4-propan-2-yl-1-prop-2-enylimidazole |
| SMILES | C=CCn1c(COCc2ccc(OC)cc2)nc(C(C)C)c1Sc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C24H26Cl2N2O2S/c1-5-10-28-22(15-30-14-17-6-8-20(29-4)9-7-17)27-23(16(2)3)24(28)31-21-12-18(25)11-19(26)13-21/h5-9,11-13,16H,1,10,14-15H2,2-4H3 |
| InChIKey | OBSZXOHXJWKPDT-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|