About 2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate
2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate (PubChem CID 22130544) has the molecular formula C22H23Cl2N3O2S
and a molecular weight of 464.42 g/mol. Its IUPAC name is 2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate.
Molecular Properties
| Compound Name | 2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate |
| PubChem CID | 22130544 |
| Molecular Formula | C22H23Cl2N3O2S |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate |
| SMILES | CC(=O)OCCc1nc(C(C)C)c(Sc2cc(Cl)cc(Cl)c2)n1Cc1ccccn1 |
| InChI | InChI=1S/C22H23Cl2N3O2S/c1-14(2)21-22(30-19-11-16(23)10-17(24)12-19)27(13-18-6-4-5-8-25-18)20(26-21)7-9-29-15(3)28/h4-6,8,10-12,14H,7,9,13H2,1-3H3 |
| InChIKey | VMOHCDNDAJGZKG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate?
The IUPAC name of 2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate (CID 22130544) is 2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate.
What is the SMILES notation for 2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate?
The canonical SMILES for 2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate is CC(=O)OCCc1nc(C(C)C)c(Sc2cc(Cl)cc(Cl)c2)n1Cc1ccccn1.
What is the InChIKey of 2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate?
The InChIKey is VMOHCDNDAJGZKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23Cl2N3O2S/c1-14(2)21-22(30-19-11-16(23)10-17(24)12-19)27(13-18-6-4-5-8-25-18)20(26-21)7-9-29-15(3)28/h4-6,8,10-12,14H,7,9,13H2,1-3H3.
What are the key properties of 2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate?
2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate has a molecular weight of 464.42 g/mol, XLogP of 6.01, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl acetate is sourced from PubChem (CID 22130544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).