C22H25ClN4O2S — CID 22130571
3-[5-(3-chlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]propyl carbamate (PubChem CID 22130571) has the molecular formula C22H25ClN4O2S and a molecular weight of 444.99 g/mol. Its IUPAC name is 3-[5-(3-chlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]propyl carbamate.
| Compound Name | 3-[5-(3-chlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]propyl carbamate |
|---|---|
| PubChem CID | 22130571 |
| Molecular Formula | C22H25ClN4O2S |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 3-[5-(3-chlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-2-ylmethyl)imidazol-2-yl]propyl carbamate |
| SMILES | CC(C)c1nc(CCCOC(N)=O)n(Cc2ccccn2)c1Sc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H25ClN4O2S/c1-15(2)20-21(30-18-9-5-7-16(23)13-18)27(14-17-8-3-4-11-25-17)19(26-20)10-6-12-29-22(24)28/h3-5,7-9,11,13,15H,6,10,12,14H2,1-2H3,(H2,24,28) |
| InChIKey | WYJUIEHAIVYWCE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|