C25H28Cl2N2O3S — CID 54473902
2-[5-(3,5-dichlorophenyl)sulfanyl-2-(2-phenylmethoxyethyl)-4-propan-2-ylimidazol-1-yl]butanoic acid (PubChem CID 54473902) has the molecular formula C25H28Cl2N2O3S and a molecular weight of 507.48 g/mol. Its IUPAC name is 2-[5-(3,5-dichlorophenyl)sulfanyl-2-(2-phenylmethoxyethyl)-4-propan-2-ylimidazol-1-yl]butanoic acid.
| Compound Name | 2-[5-(3,5-dichlorophenyl)sulfanyl-2-(2-phenylmethoxyethyl)-4-propan-2-ylimidazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 54473902 |
| Molecular Formula | C25H28Cl2N2O3S |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 2-[5-(3,5-dichlorophenyl)sulfanyl-2-(2-phenylmethoxyethyl)-4-propan-2-ylimidazol-1-yl]butanoic acid |
| SMILES | CCC(C(=O)O)n1c(CCOCc2ccccc2)nc(C(C)C)c1Sc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C25H28Cl2N2O3S/c1-4-21(25(30)31)29-22(10-11-32-15-17-8-6-5-7-9-17)28-23(16(2)3)24(29)33-20-13-18(26)12-19(27)14-20/h5-9,12-14,16,21H,4,10-11,15H2,1-3H3,(H,30,31) |
| InChIKey | XKFHITQDSHIILL-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|