C29H39Cl2N4O6PS — CID 89222468
[1-[[6-(dibutoxyphosphorylmethoxy)-3-pyridinyl]methyl]-5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]methyl carbamate (PubChem CID 89222468) has the molecular formula C29H39Cl2N4O6PS and a molecular weight of 673.60 g/mol. Its IUPAC name is [1-[[6-(dibutoxyphosphorylmethoxy)-3-pyridinyl]methyl]-5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]methyl carbamate.
| Compound Name | [1-[[6-(dibutoxyphosphorylmethoxy)-3-pyridinyl]methyl]-5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]methyl carbamate |
|---|---|
| PubChem CID | 89222468 |
| Molecular Formula | C29H39Cl2N4O6PS |
| Molecular Weight | 673.60 g/mol |
| Exact Mass | 672.17 |
| IUPAC Name | [1-[[6-(dibutoxyphosphorylmethoxy)-3-pyridinyl]methyl]-5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]methyl carbamate |
| SMILES | CCCCOP(=O)(COc1ccc(Cn2c(COC(N)=O)nc(C(C)C)c2Sc2cc(Cl)cc(Cl)c2)cn1)OCCCC |
| InChI | InChI=1S/C29H39Cl2N4O6PS/c1-5-7-11-40-42(37,41-12-8-6-2)19-39-26-10-9-21(16-33-26)17-35-25(18-38-29(32)36)34-27(20(3)4)28(35)43-24-14-22(30)13-23(31)15-24/h9-10,13-16,20H,5-8,11-12,17-19H2,1-4H3,(H2,32,36) |
| InChIKey | IUNWPFRDCFREAY-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.60 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|