About [5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate
[5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate (PubChem CID 22130587) has the molecular formula C17H21F2N3O2S
and a molecular weight of 369.44 g/mol. Its IUPAC name is [5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate.
Molecular Properties
| Compound Name | [5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate |
| PubChem CID | 22130587 |
| Molecular Formula | C17H21F2N3O2S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | [5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate |
| SMILES | CCCn1c(COC(N)=O)nc(C(C)C)c1Sc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H21F2N3O2S/c1-4-5-22-14(9-24-17(20)23)21-15(10(2)3)16(22)25-13-7-11(18)6-12(19)8-13/h6-8,10H,4-5,9H2,1-3H3,(H2,20,23) |
| InChIKey | FSDVWYHQWDMKDN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate?
The IUPAC name of [5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate (CID 22130587) is [5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate.
What is the SMILES notation for [5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate?
The canonical SMILES for [5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate is CCCn1c(COC(N)=O)nc(C(C)C)c1Sc1cc(F)cc(F)c1.
What is the InChIKey of [5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate?
The InChIKey is FSDVWYHQWDMKDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2N3O2S/c1-4-5-22-14(9-24-17(20)23)21-15(10(2)3)16(22)25-13-7-11(18)6-12(19)8-13/h6-8,10H,4-5,9H2,1-3H3,(H2,20,23).
What are the key properties of [5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate?
[5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate has a molecular weight of 369.44 g/mol, XLogP of 4.44, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,5-difluorophenyl)sulfanyl-4-propan-2-yl-1-propylimidazol-2-yl]methyl carbamate is sourced from PubChem (CID 22130587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).