C23H30Cl2N3O6PS — CID 10099695
[5-(3,5-dichlorophenyl)sulfanyl-1-[4-(diethoxyphosphorylmethoxy)but-2-ynyl]-4-propan-2-ylimidazol-2-yl]methyl carbamate (PubChem CID 10099695) has the molecular formula C23H30Cl2N3O6PS and a molecular weight of 578.46 g/mol. Its IUPAC name is [5-(3,5-dichlorophenyl)sulfanyl-1-[4-(diethoxyphosphorylmethoxy)but-2-ynyl]-4-propan-2-ylimidazol-2-yl]methyl carbamate.
| Compound Name | [5-(3,5-dichlorophenyl)sulfanyl-1-[4-(diethoxyphosphorylmethoxy)but-2-ynyl]-4-propan-2-ylimidazol-2-yl]methyl carbamate |
|---|---|
| PubChem CID | 10099695 |
| Molecular Formula | C23H30Cl2N3O6PS |
| Molecular Weight | 578.46 g/mol |
| Exact Mass | 577.10 |
| IUPAC Name | [5-(3,5-dichlorophenyl)sulfanyl-1-[4-(diethoxyphosphorylmethoxy)but-2-ynyl]-4-propan-2-ylimidazol-2-yl]methyl carbamate |
| SMILES | CCOP(=O)(COCC#CCn1c(COC(N)=O)nc(C(C)C)c1Sc1cc(Cl)cc(Cl)c1)OCC |
| InChI | InChI=1S/C23H30Cl2N3O6PS/c1-5-33-35(30,34-6-2)15-31-10-8-7-9-28-20(14-32-23(26)29)27-21(16(3)4)22(28)36-19-12-17(24)11-18(25)13-19/h11-13,16H,5-6,9-10,14-15H2,1-4H3,(H2,26,29) |
| InChIKey | FZPBFSVLZAEZGD-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.46 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|