C23H35N3O2S — CID 22130037
2-[5-(3,5-dimethylphenyl)sulfanyl-1-hexyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate (PubChem CID 22130037) has the molecular formula C23H35N3O2S and a molecular weight of 417.62 g/mol. Its IUPAC name is 2-[5-(3,5-dimethylphenyl)sulfanyl-1-hexyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate.
| Compound Name | 2-[5-(3,5-dimethylphenyl)sulfanyl-1-hexyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate |
|---|---|
| PubChem CID | 22130037 |
| Molecular Formula | C23H35N3O2S |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 2-[5-(3,5-dimethylphenyl)sulfanyl-1-hexyl-4-propan-2-ylimidazol-2-yl]ethyl carbamate |
| SMILES | CCCCCCn1c(CCOC(N)=O)nc(C(C)C)c1Sc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C23H35N3O2S/c1-6-7-8-9-11-26-20(10-12-28-23(24)27)25-21(16(2)3)22(26)29-19-14-17(4)13-18(5)15-19/h13-16H,6-12H2,1-5H3,(H2,24,27) |
| InChIKey | PLUWZEXADJEEIH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|