About 5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine
5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine (PubChem CID 22130397) has the molecular formula C16H23F2N3S
and a molecular weight of 327.44 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine.
Molecular Properties
| Compound Name | 5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine |
| PubChem CID | 22130397 |
| Molecular Formula | C16H23F2N3S |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine |
| SMILES | CCn1c(C)nc(C(C)C)c1Sc1cc(F)cc(F)c1.CN |
| InChI | InChI=1S/C15H18F2N2S.CH5N/c1-5-19-10(4)18-14(9(2)3)15(19)20-13-7-11(16)6-12(17)8-13;1-2/h6-9H,5H2,1-4H3;2H2,1H3 |
| InChIKey | UUSDHGINBUURNU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine?
The IUPAC name of 5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine (CID 22130397) is 5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine.
What is the SMILES notation for 5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine?
The canonical SMILES for 5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine is CCn1c(C)nc(C(C)C)c1Sc1cc(F)cc(F)c1.CN.
What is the InChIKey of 5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine?
The InChIKey is UUSDHGINBUURNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2N2S.CH5N/c1-5-19-10(4)18-14(9(2)3)15(19)20-13-7-11(16)6-12(17)8-13;1-2/h6-9H,5H2,1-4H3;2H2,1H3.
What are the key properties of 5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine?
5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine has a molecular weight of 327.44 g/mol, XLogP of 4.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-difluorophenyl)sulfanyl-1-ethyl-2-methyl-4-propan-2-ylimidazole;methanamine is sourced from PubChem (CID 22130397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).