C21H23F2N3OS — CID 22130658
2-[1-[(4-aminophenyl)methyl]-5-(3,5-difluorophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]ethanol (PubChem CID 22130658) has the molecular formula C21H23F2N3OS and a molecular weight of 403.50 g/mol. Its IUPAC name is 2-[1-[(4-aminophenyl)methyl]-5-(3,5-difluorophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]ethanol.
| Compound Name | 2-[1-[(4-aminophenyl)methyl]-5-(3,5-difluorophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]ethanol |
|---|---|
| PubChem CID | 22130658 |
| Molecular Formula | C21H23F2N3OS |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-[1-[(4-aminophenyl)methyl]-5-(3,5-difluorophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]ethanol |
| SMILES | CC(C)c1nc(CCO)n(Cc2ccc(N)cc2)c1Sc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C21H23F2N3OS/c1-13(2)20-21(28-18-10-15(22)9-16(23)11-18)26(19(25-20)7-8-27)12-14-3-5-17(24)6-4-14/h3-6,9-11,13,27H,7-8,12,24H2,1-2H3 |
| InChIKey | HHFMIKXLXPLPIR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|