C36H44Cl2N5O6PS — CID 10485366
butyl (2S)-2-[[3-[[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methoxycarbonylamino]propyl-phenoxyphosphoryl]amino]propanoate (PubChem CID 10485366) has the molecular formula C36H44Cl2N5O6PS and a molecular weight of 776.72 g/mol. Its IUPAC name is butyl (2S)-2-[[3-[[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methoxycarbonylamino]propyl-phenoxyphosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[3-[[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methoxycarbonylamino]propyl-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 10485366 |
| Molecular Formula | C36H44Cl2N5O6PS |
| Molecular Weight | 776.72 g/mol |
| Exact Mass | 775.21 |
| IUPAC Name | butyl (2S)-2-[[3-[[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methoxycarbonylamino]propyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(CCCNC(=O)OCc1nc(C(C)C)c(Sc2cc(Cl)cc(Cl)c2)n1Cc1ccncc1)Oc1ccccc1 |
| InChI | InChI=1S/C36H44Cl2N5O6PS/c1-5-6-18-47-35(44)26(4)42-50(46,49-30-11-8-7-9-12-30)19-10-15-40-36(45)48-24-32-41-33(25(2)3)34(43(32)23-27-13-16-39-17-14-27)51-31-21-28(37)20-29(38)22-31/h7-9,11-14,16-17,20-22,25-26H,5-6,10,15,18-19,23-24H2,1-4H3,(H,40,45)(H,42,46)/t26-,50?/m0/s1 |
| InChIKey | HXOIEAMVNHWEAR-PHJSXTQASA-N |
| XLogP | 9.12 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.72 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|