C28H33Cl2N4O3S- — CID 21147467
N-[[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methyl]-N-octanoylcarbamate (PubChem CID 21147467) has the molecular formula C28H33Cl2N4O3S- and a molecular weight of 576.57 g/mol. Its IUPAC name is N-[[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methyl]-N-octanoylcarbamate.
| Compound Name | N-[[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methyl]-N-octanoylcarbamate |
|---|---|
| PubChem CID | 21147467 |
| Molecular Formula | C28H33Cl2N4O3S- |
| Molecular Weight | 576.57 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | N-[[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methyl]-N-octanoylcarbamate |
| SMILES | CCCCCCCC(=O)N(Cc1nc(C(C)C)c(Sc2cc(Cl)cc(Cl)c2)n1Cc1ccncc1)C(=O)[O-] |
| InChI | InChI=1S/C28H34Cl2N4O3S/c1-4-5-6-7-8-9-25(35)34(28(36)37)18-24-32-26(19(2)3)27(33(24)17-20-10-12-31-13-11-20)38-23-15-21(29)14-22(30)16-23/h10-16,19H,4-9,17-18H2,1-3H3,(H,36,37)/p-1 |
| InChIKey | ZTEVWRMKPXZVQW-UHFFFAOYSA-M |
| XLogP | 6.94 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.57 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|