C16H20ClN3O2S — CID 22130779
5-(3-chlorophenyl)sulfanyl-1,2-dimethyl-4-propan-2-ylimidazole;2-methyloxaziridin-3-one (PubChem CID 22130779) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is 5-(3-chlorophenyl)sulfanyl-1,2-dimethyl-4-propan-2-ylimidazole;2-methyloxaziridin-3-one.
| Compound Name | 5-(3-chlorophenyl)sulfanyl-1,2-dimethyl-4-propan-2-ylimidazole;2-methyloxaziridin-3-one |
|---|---|
| PubChem CID | 22130779 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 5-(3-chlorophenyl)sulfanyl-1,2-dimethyl-4-propan-2-ylimidazole;2-methyloxaziridin-3-one |
| SMILES | CN1OC1=O.Cc1nc(C(C)C)c(Sc2cccc(Cl)c2)n1C |
| InChI | InChI=1S/C14H17ClN2S.C2H3NO2/c1-9(2)13-14(17(4)10(3)16-13)18-12-7-5-6-11(15)8-12;1-3-2(4)5-3/h5-9H,1-4H3;1H3 |
| InChIKey | RYIZEOQYTIHTAK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 50.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|