C17H22N2O2S — CID 70000480
methyl 3-(1-methyl-5-phenylsulfanyl-4-propan-2-ylimidazol-2-yl)propanoate (PubChem CID 70000480) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is methyl 3-(1-methyl-5-phenylsulfanyl-4-propan-2-ylimidazol-2-yl)propanoate.
| Compound Name | methyl 3-(1-methyl-5-phenylsulfanyl-4-propan-2-ylimidazol-2-yl)propanoate |
|---|---|
| PubChem CID | 70000480 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | methyl 3-(1-methyl-5-phenylsulfanyl-4-propan-2-ylimidazol-2-yl)propanoate |
| SMILES | COC(=O)CCc1nc(C(C)C)c(Sc2ccccc2)n1C |
| InChI | InChI=1S/C17H22N2O2S/c1-12(2)16-17(22-13-8-6-5-7-9-13)19(3)14(18-16)10-11-15(20)21-4/h5-9,12H,10-11H2,1-4H3 |
| InChIKey | GGPCNTARSGVYHM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |