C20H24N4O3S — CID 174338084
phenyl 2-(2-aminoethyl)-5-propan-2-yl-3-(pyridin-2-ylmethyl)imidazole-4-sulfonate (PubChem CID 174338084) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is phenyl 2-(2-aminoethyl)-5-propan-2-yl-3-(pyridin-2-ylmethyl)imidazole-4-sulfonate.
| Compound Name | phenyl 2-(2-aminoethyl)-5-propan-2-yl-3-(pyridin-2-ylmethyl)imidazole-4-sulfonate |
|---|---|
| PubChem CID | 174338084 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | phenyl 2-(2-aminoethyl)-5-propan-2-yl-3-(pyridin-2-ylmethyl)imidazole-4-sulfonate |
| SMILES | CC(C)c1nc(CCN)n(Cc2ccccn2)c1S(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H24N4O3S/c1-15(2)19-20(28(25,26)27-17-9-4-3-5-10-17)24(18(23-19)11-12-21)14-16-8-6-7-13-22-16/h3-10,13,15H,11-12,14,21H2,1-2H3 |
| InChIKey | HLJVPTBIJAJAHH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|