C21H24F2N4O3S — CID 174328075
(3,5-difluorophenyl) 2-[(dimethylamino)methyl]-5-propan-2-yl-3-(pyridin-4-ylmethyl)imidazole-4-sulfonate (PubChem CID 174328075) has the molecular formula C21H24F2N4O3S and a molecular weight of 450.51 g/mol. Its IUPAC name is (3,5-difluorophenyl) 2-[(dimethylamino)methyl]-5-propan-2-yl-3-(pyridin-4-ylmethyl)imidazole-4-sulfonate.
| Compound Name | (3,5-difluorophenyl) 2-[(dimethylamino)methyl]-5-propan-2-yl-3-(pyridin-4-ylmethyl)imidazole-4-sulfonate |
|---|---|
| PubChem CID | 174328075 |
| Molecular Formula | C21H24F2N4O3S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | (3,5-difluorophenyl) 2-[(dimethylamino)methyl]-5-propan-2-yl-3-(pyridin-4-ylmethyl)imidazole-4-sulfonate |
| SMILES | CC(C)c1nc(CN(C)C)n(Cc2ccncc2)c1S(=O)(=O)Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C21H24F2N4O3S/c1-14(2)20-21(31(28,29)30-18-10-16(22)9-17(23)11-18)27(19(25-20)13-26(3)4)12-15-5-7-24-8-6-15/h5-11,14H,12-13H2,1-4H3 |
| InChIKey | GTHXMVSHYTWEKI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|