C27H25N3O3 — CID 135621528
N-[(E)-1-(2,5-dihydroxyphenyl)ethylideneamino]-2-(4-ethylphenyl)-6-methylquinoline-4-carboxamide (PubChem CID 135621528) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[(E)-1-(2,5-dihydroxyphenyl)ethylideneamino]-2-(4-ethylphenyl)-6-methylquinoline-4-carboxamide.
| Compound Name | N-[(E)-1-(2,5-dihydroxyphenyl)ethylideneamino]-2-(4-ethylphenyl)-6-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 135621528 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[(E)-1-(2,5-dihydroxyphenyl)ethylideneamino]-2-(4-ethylphenyl)-6-methylquinoline-4-carboxamide |
| SMILES | CCc1ccc(-c2cc(C(=O)N/N=C(\C)c3cc(O)ccc3O)c3cc(C)ccc3n2)cc1 |
| InChI | InChI=1S/C27H25N3O3/c1-4-18-6-8-19(9-7-18)25-15-23(22-13-16(2)5-11-24(22)28-25)27(33)30-29-17(3)21-14-20(31)10-12-26(21)32/h5-15,31-32H,4H2,1-3H3,(H,30,33)/b29-17+ |
| InChIKey | FSKPZMHSPLRVPD-STBIYBPSSA-N |
| XLogP | 5.34 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|