C18H20O11S — CID 135623717
5,8-dihydroxy-2,3-dimethoxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylnaphthalene-1,4-dione (PubChem CID 135623717) has the molecular formula C18H20O11S and a molecular weight of 444.41 g/mol. Its IUPAC name is 5,8-dihydroxy-2,3-dimethoxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylnaphthalene-1,4-dione.
| Compound Name | 5,8-dihydroxy-2,3-dimethoxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 135623717 |
| Molecular Formula | C18H20O11S |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 5,8-dihydroxy-2,3-dimethoxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylnaphthalene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)c2c(O)c(S[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c2C1=O |
| InChI | InChI=1S/C18H20O11S/c1-27-16-12(23)8-5(20)3-7(11(22)9(8)13(24)17(16)28-2)30-18-15(26)14(25)10(21)6(4-19)29-18/h3,6,10,14-15,18-22,25-26H,4H2,1-2H3/t6-,10-,14+,15-,18+/m1/s1 |
| InChIKey | AUIBSIJWVKVSCV-HJAPCFNTSA-N |
| XLogP | -1.13 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|