C12H15KO9S2 — CID 23706226
potassium [2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylphenyl] sulfate (PubChem CID 23706226) has the molecular formula C12H15KO9S2 and a molecular weight of 406.48 g/mol. Its IUPAC name is potassium [2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylphenyl] sulfate.
| Compound Name | potassium [2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylphenyl] sulfate |
|---|---|
| PubChem CID | 23706226 |
| Molecular Formula | C12H15KO9S2 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | potassium [2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylphenyl] sulfate |
| SMILES | O=S(=O)([O-])Oc1ccccc1S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O.[K+] |
| InChI | InChI=1S/C12H16O9S2.K/c13-5-7-9(14)10(15)11(16)12(20-7)22-8-4-2-1-3-6(8)21-23(17,18)19;/h1-4,7,9-16H,5H2,(H,17,18,19);/q;+1/p-1/t7-,9-,10+,11-,12+;/m1./s1 |
| InChIKey | FRXSBOGUOADSLP-YGPFZAKASA-M |
| XLogP | -4.58 |
| TPSA | 156.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | -4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|