C24H28N4O7 — CID 135623864
2-(2-methoxyethoxy)ethyl 2-[[5-cyano-6-hydroxy-4-methyl-2-oxo-1-(oxolan-2-ylmethyl)-3-pyridinyl]diazenyl]benzoate (PubChem CID 135623864) has the molecular formula C24H28N4O7 and a molecular weight of 484.51 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 2-[[5-cyano-6-hydroxy-4-methyl-2-oxo-1-(oxolan-2-ylmethyl)-3-pyridinyl]diazenyl]benzoate.
| Compound Name | 2-(2-methoxyethoxy)ethyl 2-[[5-cyano-6-hydroxy-4-methyl-2-oxo-1-(oxolan-2-ylmethyl)-3-pyridinyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 135623864 |
| Molecular Formula | C24H28N4O7 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 2-[[5-cyano-6-hydroxy-4-methyl-2-oxo-1-(oxolan-2-ylmethyl)-3-pyridinyl]diazenyl]benzoate |
| SMILES | COCCOCCOC(=O)c1ccccc1/N=N/c1c(C)c(C#N)c(O)n(CC2CCCO2)c1=O |
| InChI | InChI=1S/C24H28N4O7/c1-16-19(14-25)22(29)28(15-17-6-5-9-34-17)23(30)21(16)27-26-20-8-4-3-7-18(20)24(31)35-13-12-33-11-10-32-2/h3-4,7-8,17,29H,5-6,9-13,15H2,1-2H3/b27-26+ |
| InChIKey | ATJIGWPUXJWACP-CYYJNZCTSA-N |
| XLogP | 3.15 |
| TPSA | 144.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|