C21H20N3O5- — CID 135625144
(2R)-3-(4-hydroxyphenyl)-2-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]propanoate (PubChem CID 135625144) has the molecular formula C21H20N3O5- and a molecular weight of 394.41 g/mol. Its IUPAC name is (2R)-3-(4-hydroxyphenyl)-2-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]propanoate.
| Compound Name | (2R)-3-(4-hydroxyphenyl)-2-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]propanoate |
|---|---|
| PubChem CID | 135625144 |
| Molecular Formula | C21H20N3O5- |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (2R)-3-(4-hydroxyphenyl)-2-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]propanoate |
| SMILES | O=C(CCCc1nc2ccccc2c(=O)[nH]1)N[C@H](Cc1ccc(O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C21H21N3O5/c25-14-10-8-13(9-11-14)12-17(21(28)29)23-19(26)7-3-6-18-22-16-5-2-1-4-15(16)20(27)24-18/h1-2,4-5,8-11,17,25H,3,6-7,12H2,(H,23,26)(H,28,29)(H,22,24,27)/p-1/t17-/m1/s1 |
| InChIKey | ZKASVHPMGRSRSW-QGZVFWFLSA-M |
| XLogP | 0.43 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |