C22H23N3O4 — CID 136990447
4-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]-4-phenylbutanoic acid (PubChem CID 136990447) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 4-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]-4-phenylbutanoic acid.
| Compound Name | 4-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 136990447 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 4-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]-4-phenylbutanoic acid |
| SMILES | O=C(O)CCC(NC(=O)CCCc1nc2ccccc2c(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O4/c26-20(24-17(13-14-21(27)28)15-7-2-1-3-8-15)12-6-11-19-23-18-10-5-4-9-16(18)22(29)25-19/h1-5,7-10,17H,6,11-14H2,(H,24,26)(H,27,28)(H,23,25,29) |
| InChIKey | XYFREANDKCSZFS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |