C23H34N4O4 — CID 136817033
tert-butyl N-[(2S)-2-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]hexyl]carbamate (PubChem CID 136817033) has the molecular formula C23H34N4O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]hexyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 136817033 |
| Molecular Formula | C23H34N4O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | tert-butyl N-[(2S)-2-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]hexyl]carbamate |
| SMILES | CCCC[C@@H](CNC(=O)OC(C)(C)C)NC(=O)CCCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C23H34N4O4/c1-5-6-10-16(15-24-22(30)31-23(2,3)4)25-20(28)14-9-13-19-26-18-12-8-7-11-17(18)21(29)27-19/h7-8,11-12,16H,5-6,9-10,13-15H2,1-4H3,(H,24,30)(H,25,28)(H,26,27,29)/t16-/m0/s1 |
| InChIKey | SBPPUILVLFRXBN-INIZCTEOSA-N |
| XLogP | 3.45 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |