C23H18Cl2N2O2 — CID 135627948
2,2-bis(4-chlorophenyl)-N-[(E)-(4-hydroxyphenyl)methylideneamino]cyclopropane-1-carboxamide (PubChem CID 135627948) has the molecular formula C23H18Cl2N2O2 and a molecular weight of 425.32 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenyl)-N-[(E)-(4-hydroxyphenyl)methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | 2,2-bis(4-chlorophenyl)-N-[(E)-(4-hydroxyphenyl)methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 135627948 |
| Molecular Formula | C23H18Cl2N2O2 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 2,2-bis(4-chlorophenyl)-N-[(E)-(4-hydroxyphenyl)methylideneamino]cyclopropane-1-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(O)cc1)C1CC1(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18Cl2N2O2/c24-18-7-3-16(4-8-18)23(17-5-9-19(25)10-6-17)13-21(23)22(29)27-26-14-15-1-11-20(28)12-2-15/h1-12,14,21,28H,13H2,(H,27,29)/b26-14+ |
| InChIKey | XNRIDFYSTGXNRY-VULFUBBASA-N |
| XLogP | 5.16 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|