C26H30N4O2S — CID 135631065
N-[2-(cyclohexen-1-yl)ethyl]-1-(4-oxo-7-phenyl-3H-thieno[3,2-d]pyrimidin-2-yl)piperidine-3-carboxamide (PubChem CID 135631065) has the molecular formula C26H30N4O2S and a molecular weight of 462.62 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-(4-oxo-7-phenyl-3H-thieno[3,2-d]pyrimidin-2-yl)piperidine-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-(4-oxo-7-phenyl-3H-thieno[3,2-d]pyrimidin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 135631065 |
| Molecular Formula | C26H30N4O2S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-(4-oxo-7-phenyl-3H-thieno[3,2-d]pyrimidin-2-yl)piperidine-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1CCCN(c2nc3c(-c4ccccc4)csc3c(=O)[nH]2)C1 |
| InChI | InChI=1S/C26H30N4O2S/c31-24(27-14-13-18-8-3-1-4-9-18)20-12-7-15-30(16-20)26-28-22-21(19-10-5-2-6-11-19)17-33-23(22)25(32)29-26/h2,5-6,8,10-11,17,20H,1,3-4,7,9,12-16H2,(H,27,31)(H,28,29,32) |
| InChIKey | UWJYLYAFBYNAAD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|