C27H32N4O2S — CID 135631185
N-[2-(cyclohexen-1-yl)ethyl]-1-[7-(2-methylphenyl)-4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl]piperidine-3-carboxamide (PubChem CID 135631185) has the molecular formula C27H32N4O2S and a molecular weight of 476.65 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-[7-(2-methylphenyl)-4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl]piperidine-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-[7-(2-methylphenyl)-4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 135631185 |
| Molecular Formula | C27H32N4O2S |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-[7-(2-methylphenyl)-4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl]piperidine-3-carboxamide |
| SMILES | Cc1ccccc1-c1csc2c(=O)[nH]c(N3CCCC(C(=O)NCCC4=CCCCC4)C3)nc12 |
| InChI | InChI=1S/C27H32N4O2S/c1-18-8-5-6-12-21(18)22-17-34-24-23(22)29-27(30-26(24)33)31-15-7-11-20(16-31)25(32)28-14-13-19-9-3-2-4-10-19/h5-6,8-9,12,17,20H,2-4,7,10-11,13-16H2,1H3,(H,28,32)(H,29,30,33) |
| InChIKey | TWCHCCHDGNPMHW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|