C18H20N4O2 — CID 135632393
5-[(3-methoxyanilino)methyl]-2-(2-phenylethyl)-4H-1,2,4-triazol-3-one (PubChem CID 135632393) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 5-[(3-methoxyanilino)methyl]-2-(2-phenylethyl)-4H-1,2,4-triazol-3-one.
| Compound Name | 5-[(3-methoxyanilino)methyl]-2-(2-phenylethyl)-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 135632393 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 5-[(3-methoxyanilino)methyl]-2-(2-phenylethyl)-4H-1,2,4-triazol-3-one |
| SMILES | COc1cccc(NCc2nn(CCc3ccccc3)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C18H20N4O2/c1-24-16-9-5-8-15(12-16)19-13-17-20-18(23)22(21-17)11-10-14-6-3-2-4-7-14/h2-9,12,19H,10-11,13H2,1H3,(H,20,21,23) |
| InChIKey | LNLLRWZWJUVMFH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |